Difference between revisions of "ALLANTOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8900 == * common-name: ** a [protein] n6,n6-dimethyl-l-lysine == Reaction(s) known to consume the compound == * RXN-13186 * RXN...") |
(Created page with "Category:metabolite == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == * common-name: ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate |
| + | * smiles: | ||
| + | ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** ovprppovaxrced-wvzvxsggsa-k | ||
| + | * molecular-weight: | ||
| + | ** 255.098 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[KDPGALDOL-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PGLUCONDEHYDRAT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-dehydro-3-deoxy-d-gluconate 6-phosphate}} |
| + | {{#set: inchi-key=inchikey=ovprppovaxrced-wvzvxsggsa-k}} | ||
| + | {{#set: molecular-weight=255.098}} | ||
Revision as of 08:29, 15 March 2021
Contents
Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE
- common-name:
- 2-dehydro-3-deoxy-d-gluconate 6-phosphate
- smiles:
- c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- ovprppovaxrced-wvzvxsggsa-k
- molecular-weight:
- 255.098
