Difference between revisions of "ALLANTOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == * common-name: ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-...") |
(Created page with "Category:metabolite == Metabolite ALLANTOATE == * common-name: ** allantoate * smiles: ** c(c(=o)[o-])(nc(=o)n)nc(=o)n * inchi-key: ** nucljnswzchrkl-uhfffaoysa-m * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALLANTOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** allantoate |
* smiles: | * smiles: | ||
| − | ** c(=o) | + | ** c(c(=o)[o-])(nc(=o)n)nc(=o)n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nucljnswzchrkl-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 175.124 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALLANTOICASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=allantoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nucljnswzchrkl-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=175.124}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ALLANTOATE
- common-name:
- allantoate
- smiles:
- c(c(=o)[o-])(nc(=o)n)nc(=o)n
- inchi-key:
- nucljnswzchrkl-uhfffaoysa-m
- molecular-weight:
- 175.124
