Difference between revisions of "ALLANTOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:metabolite == Metabolite ALLANTOATE == * common-name: ** allantoate * smiles: ** c(c(=o)[o-])(nc(=o)n)nc(=o)n * inchi-key: ** nucljnswzchrkl-uhfffaoysa-m * molecu...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] ==
+
== Metabolite ALLANTOATE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** allantoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.77 ec-1.3.1.77]
+
** c(c(=o)[o-])(nc(=o)n)nc(=o)n
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-591]][c] '''+''' 2 [[NADPH]][c] '''+''' 3 [[PROTON]][c] '''=>''' 1 [[CPD-7630]][c] '''+''' 2 [[NADP]][c]
+
** nucljnswzchrkl-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ21972]]
+
** 175.124
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ALLANTOICASE-RXN]]
−
* Gene: [[SJ06064]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=allantoate}}
−
* Gene: [[SJ12213]]
+
{{#set: inchi-key=inchikey=nucljnswzchrkl-uhfffaoysa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=175.124}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6035]], 2,3-cis-flavanols biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06542 R06542]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.3.1.77}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite ALLANTOATE

  • common-name:
    • allantoate
  • smiles:
    • c(c(=o)[o-])(nc(=o)n)nc(=o)n
  • inchi-key:
    • nucljnswzchrkl-uhfffaoysa-m
  • molecular-weight:
    • 175.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ALLANTOATE&oldid=138834"