Difference between revisions of "ALLANTOATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9615 RXN-9615] == * direction: ** left-to-right == Reaction formula == * 1 AMMONIUM[e] '''=...") |
(Created page with "Category:metabolite == Metabolite ALLANTOATE == * common-name: ** allantoate * smiles: ** c(c(=o)[o-])(nc(=o)n)nc(=o)n * inchi-key: ** nucljnswzchrkl-uhfffaoysa-m * molecu...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ALLANTOATE == |
| − | * | + | * common-name: |
| − | ** | + | ** allantoate |
| − | + | * smiles: | |
| − | * | + | ** c(c(=o)[o-])(nc(=o)n)nc(=o)n |
| − | == | + | * inchi-key: |
| − | * | + | ** nucljnswzchrkl-uhfffaoysa-m |
| − | ** | + | * molecular-weight: |
| − | * | + | ** 175.124 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[ALLANTOICASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=allantoate}} | |
| − | * | + | {{#set: inchi-key=inchikey=nucljnswzchrkl-uhfffaoysa-m}} |
| − | == | + | {{#set: molecular-weight=175.124}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ALLANTOATE
- common-name:
- allantoate
- smiles:
- c(c(=o)[o-])(nc(=o)n)nc(=o)n
- inchi-key:
- nucljnswzchrkl-uhfffaoysa-m
- molecular-weight:
- 175.124
