Difference between revisions of "ALLANTOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18491 == * common-name: ** (6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(...")
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18491 ==
+
== Metabolite DCTP ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+
** dctp
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** xzynvqdkyrhkfg-qojzhlsosa-j
+
** rgwhqcvhvjxokc-shyzeuofsa-j
 
* molecular-weight:
 
* molecular-weight:
** 1104.05
+
** 463.127
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17113]]
+
* [[DCTCP]]
 +
* [[DCTP-PYROPHOSPHATASE-RXN]]
 +
* [[DCTPtm]]
 +
* [[DCTUP]]
 +
* [[RXN-14198]]
 +
* [[RXN-14216]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17112]]
+
* [[ATDCD]]
 +
* [[ATDCDm]]
 +
* [[DCDPKIN-RXN]]
 +
* [[DCTPtm]]
 +
* [[RXN0-723]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+
{{#set: common-name=dctp}}
{{#set: inchi-key=inchikey=xzynvqdkyrhkfg-qojzhlsosa-j}}
+
{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
{{#set: molecular-weight=1104.05}}
+
{{#set: molecular-weight=463.127}}

Revision as of 15:29, 5 January 2021

Metabolite DCTP

  • common-name:
    • dctp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • rgwhqcvhvjxokc-shyzeuofsa-j
  • molecular-weight:
    • 463.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality