Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...")
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ARACHIDONIC_ACID ==
+
== Metabolite CPD-17371 ==
 
* common-name:
 
* common-name:
** arachidonate
+
** 18-hydroxylinoleoyl-coa
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** yzxbapsdxzzrgb-dofzraljsa-m
+
** hjegylshikpenr-daxvlclxsa-j
 
* molecular-weight:
 
* molecular-weight:
** 303.464
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+
* [[RXN-16118]]
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
 
* [[RXN-13395]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16016]]
 
* [[RXN6666-2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=arachidonate}}
+
{{#set: common-name=18-hydroxylinoleoyl-coa}}
{{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}}
+
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
{{#set: molecular-weight=303.464}}
+
{{#set: molecular-weight=1041.936}}

Revision as of 11:14, 15 January 2021

Metabolite CPD-17371

  • common-name:
    • 18-hydroxylinoleoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hjegylshikpenr-daxvlclxsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality