Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite FECOSTEROL == * common-name: ** fecosterol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34)))) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17371 ==
+
== Metabolite FECOSTEROL ==
 
* common-name:
 
* common-name:
** 18-hydroxylinoleoyl-coa
+
** fecosterol
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** hjegylshikpenr-daxvlclxsa-j
+
** slqkysphbzmasj-qkporzecsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
+
* [[RXN3O-203]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN3O-178]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxylinoleoyl-coa}}
+
{{#set: common-name=fecosterol}}
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
+
{{#set: inchi-key=inchikey=slqkysphbzmasj-qkporzecsa-n}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=398.671}}

Revision as of 08:26, 15 March 2021

Metabolite FECOSTEROL

  • common-name:
    • fecosterol
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • slqkysphbzmasj-qkporzecsa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality