Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite ALLO-THR == * common-name: ** dl-allothreonine == Reaction(s) known to consume the compound == * RXN0-5234 == Reaction(s) known to pr...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17371 ==
+
== Metabolite ALLO-THR ==
 
* common-name:
 
* common-name:
** 18-hydroxylinoleoyl-coa
+
** dl-allothreonine
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** hjegylshikpenr-daxvlclxsa-j
 
* molecular-weight:
 
** 1041.936
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
+
* [[RXN0-5234]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxylinoleoyl-coa}}
+
{{#set: common-name=dl-allothreonine}}
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
 
{{#set: molecular-weight=1041.936}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite ALLO-THR

  • common-name:
    • dl-allothreonine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality