Difference between revisions of "ALLO-THR"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04691 == * transcription-direction: ** positive * right-end-position: ** 102101 * left-end-position: ** 96760 * centisome-position: ** 94.02939...") |
(Created page with "Category:metabolite == Metabolite CPD0-1445 == * common-name: ** l-alanyl-l-glutamate * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** vyzagtdahuirqa-whf...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-1445 == |
| − | * | + | * common-name: |
| − | ** | + | ** l-alanyl-l-glutamate |
| − | * | + | * smiles: |
| − | ** | + | ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** vyzagtdahuirqa-whfbiakzsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 217.201 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-6981]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=l-alanyl-l-glutamate}} | |
| − | + | {{#set: inchi-key=inchikey=vyzagtdahuirqa-whfbiakzsa-m}} | |
| − | + | {{#set: molecular-weight=217.201}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD0-1445
- common-name:
- l-alanyl-l-glutamate
- smiles:
- cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-]
- inchi-key:
- vyzagtdahuirqa-whfbiakzsa-m
- molecular-weight:
- 217.201
