Difference between revisions of "ALLYSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6701 == * common-name: ** 1d-myo-inositol 5-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite ALLYSINE == * common-name: ** (s)-2-amino-6-oxohexanoate * smiles: ** [ch](=o)cccc([n+])c(=o)[o-] * inchi-key: ** gfxytqpnnxgict-yfkpbyrv...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALLYSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-2-amino-6-oxohexanoate |
* smiles: | * smiles: | ||
− | ** | + | ** [ch](=o)cccc([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gfxytqpnnxgict-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 145.158 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.5.1.9-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-2-amino-6-oxohexanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gfxytqpnnxgict-yfkpbyrvsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.158}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite ALLYSINE
- common-name:
- (s)-2-amino-6-oxohexanoate
- smiles:
- [ch](=o)cccc([n+])c(=o)[o-]
- inchi-key:
- gfxytqpnnxgict-yfkpbyrvsa-n
- molecular-weight:
- 145.158