Difference between revisions of "ALPHA-D-GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite LC-alcohol-LC-acyl-ester == * common-name: ** a long-chain alcohol--long-chain acyl wax ester == Reaction(s) known to consume the compoun...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LC-alcohol-LC-acyl-ester == |
* common-name: | * common-name: | ||
| − | ** | + | ** a long-chain alcohol--long-chain acyl wax ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.3.1.75-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a long-chain alcohol--long-chain acyl wax ester}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite LC-alcohol-LC-acyl-ester
- common-name:
- a long-chain alcohol--long-chain acyl wax ester
