Difference between revisions of "ALPHA-D-GALACTOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.4.3-RXN 3.6.4.3-RXN] == * direction: ** left-to-right * common-name: ** microtubule-severing at...")
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.4.3-RXN 3.6.4.3-RXN] ==
+
== Metabolite ALPHA-D-GALACTOSE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** microtubule-severing atpase
+
** α-d-galactose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.6.4.3 ec-3.6.4.3]
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* n [[ATP]][c] '''+''' 1 [[Microtubules]][c] '''+''' n [[WATER]][c] '''=>''' n [[ADP]][c] '''+''' n [[PROTON]][c] '''+''' n [[Pi]][c] '''+''' n [[Tubulin-Heterodimers]][c]
+
** wqzgkkkjijffok-phyprbdbsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05159]]
+
** 180.157
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ALDOSE1EPIM-RXN]]
−
* Gene: [[SJ18614]]
+
* [[GALACTOKIN-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ALDOSE1EPIM-RXN]]
−
* Gene: [[SJ14053]]
+
* [[GALACTOKIN-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-11501]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-11502]]
−
* Gene: [[SJ21133]]
+
* [[RXN-12088]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=α-d-galactose}}
−
* Gene: [[SJ05456]]
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=180.157}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ10366]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=microtubule-severing atpase}}
 
−
{{#set: ec-number=ec-3.6.4.3}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite ALPHA-D-GALACTOSE

  • common-name:
    • α-d-galactose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-phyprbdbsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ALPHA-D-GALACTOSE&oldid=138829"