Difference between revisions of "ALPHA-D-GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OH2OXOGLUTARALDOL-RXN 4OH2OXOGLUTARALDOL-RXN] == * direction: ** reversible * ec-number: ** [http:...") |
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ALPHA-D-GALACTOSE == |
− | * | + | * common-name: |
− | ** | + | ** α-d-galactose |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
− | + | * inchi-key: | |
− | + | ** wqzgkkkjijffok-phyprbdbsa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 180.157 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[ALDOSE1EPIM-RXN]] |
− | == | + | * [[GALACTOKIN-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[ALDOSE1EPIM-RXN]] | |
− | + | * [[GALACTOKIN-RXN]] | |
− | * | + | * [[RXN-11501]] |
− | == | + | * [[RXN-11502]] |
− | * | + | * [[RXN-12088]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=α-d-galactose}} | |
− | * | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}} |
− | + | {{#set: molecular-weight=180.157}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ALPHA-D-GALACTOSE
- common-name:
- α-d-galactose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-phyprbdbsa-n
- molecular-weight:
- 180.157