Difference between revisions of "ALPHA-D-GALACTOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OH2OXOGLUTARALDOL-RXN 4OH2OXOGLUTARALDOL-RXN] == * direction: ** reversible * ec-number: ** [http:...")
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OH2OXOGLUTARALDOL-RXN 4OH2OXOGLUTARALDOL-RXN] ==
+
== Metabolite ALPHA-D-GALACTOSE ==
−
* direction:
+
* common-name:
−
** reversible
+
** α-d-galactose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.3.16 ec-4.1.3.16]
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-15015]][c] '''<=>''' 1 [[GLYOX]][c] '''+''' 1 [[PYRUVATE]][c]
+
** wqzgkkkjijffok-phyprbdbsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03464]]
+
** 180.157
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ALDOSE1EPIM-RXN]]
−
== Pathway(s) ==
+
* [[GALACTOKIN-RXN]]
−
* [[HYDROXYPRODEG-PWY]], trans-4-hydroxy-L-proline degradation I: [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPRODEG-PWY HYDROXYPRODEG-PWY]
+
== Reaction(s) known to produce the compound ==
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
* [[ALDOSE1EPIM-RXN]]
−
== Reconstruction information  ==
+
* [[GALACTOKIN-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-11501]]
−
== External links  ==
+
* [[RXN-11502]]
−
* RHEA:
+
* [[RXN-12088]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18172 18172]
+
== Reaction(s) of unknown directionality ==
−
* LIGAND-RXN:
+
{{#set: common-name=&alpha;-d-galactose}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00470 R00470]
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
−
* UNIPROT:
+
{{#set: molecular-weight=180.157}}
−
** [http://www.uniprot.org/uniprot/P44480 P44480]
 
−
** [http://www.uniprot.org/uniprot/P0A955 P0A955]
 
−
** [http://www.uniprot.org/uniprot/Q9JR44 Q9JR44]
 
−
** [http://www.uniprot.org/uniprot/O25729 O25729]
 
−
** [http://www.uniprot.org/uniprot/Q9ZKB4 Q9ZKB4]
 
−
** [http://www.uniprot.org/uniprot/O83578 O83578]
 
−
** [http://www.uniprot.org/uniprot/Q9WXS1 Q9WXS1]
 
−
** [http://www.uniprot.org/uniprot/P50846 P50846]
 
−
** [http://www.uniprot.org/uniprot/P38448 P38448]
 
−
** [http://www.uniprot.org/uniprot/Q55872 Q55872]
 
−
** [http://www.uniprot.org/uniprot/P94802 P94802]
 
−
{{#set: direction=reversible}}
 
−
{{#set: ec-number=ec-4.1.3.16}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite ALPHA-D-GALACTOSE

  • common-name:
    • α-d-galactose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-phyprbdbsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ALPHA-D-GALACTOSE&oldid=138829"