Difference between revisions of "ALPHA-D-GALACTOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5424 RXN-5424] == * direction: ** left-to-right * common-name: ** indole-3-glycol dehydrogenase...")
 
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5424 RXN-5424] ==
+
== Metabolite ALPHA-D-GALACTOSE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** indole-3-glycol dehydrogenase
+
** α-d-galactose
−
** alcohol dehydrogenase (nad)
+
* smiles:
−
* ec-number:
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
−
** [http://enzyme.expasy.org/EC/1.1.1.1 ec-1.1.1.1]
+
* inchi-key:
−
== Reaction formula ==
+
** wqzgkkkjijffok-phyprbdbsa-n
−
* 1 [[3-INDOLYLGLYCOLALDEHYDE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[INDOLE-3-GLYCOL]][c] '''+''' 1 [[NAD]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 180.157
−
* Gene: [[SJ14768]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[ALDOSE1EPIM-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[GALACTOKIN-RXN]]
−
* Gene: [[SJ07759]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ALDOSE1EPIM-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[GALACTOKIN-RXN]]
−
* Gene: [[SJ21601]]
+
* [[RXN-11501]]
−
** Category: [[annotation]]
+
* [[RXN-11502]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12088]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-3162]], L-tryptophan degradation V (side chain pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3162 PWY-3162]
+
{{#set: common-name=α-d-galactose}}
−
** '''2''' reactions found over '''13''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=180.157}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=indole-3-glycol dehydrogenase|alcohol dehydrogenase (nad)}}
 
−
{{#set: ec-number=ec-1.1.1.1}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite ALPHA-D-GALACTOSE

  • common-name:
    • α-d-galactose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-phyprbdbsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ALPHA-D-GALACTOSE&oldid=138829"