Difference between revisions of "ALPHA-D-GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPHA-D-GALACTOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-galactose |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wqzgkkkjijffok-phyprbdbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
| − | + | * [[GALACTOKIN-RXN]] | |
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
| − | * [[ | + | * [[GALACTOKIN-RXN]] |
| − | * [[ | + | * [[RXN-11501]] |
| − | * [[ | + | * [[RXN-11502]] |
| − | * [[ | + | * [[RXN-12088]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-galactose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ALPHA-D-GALACTOSE
- common-name:
- α-d-galactose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-phyprbdbsa-n
- molecular-weight:
- 180.157
