Difference between revisions of "ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-3-DIHYDROXYBENZOATE == * common-name: ** 2,3-dihydroxybenzoate * smiles: ** c(c1(=cc=cc(=c1o)o))([o-])=o * inchi-key: ** gldqamycgoijdv...") |
(Created page with "Category:metabolite == Metabolite CPD-8678 == * common-name: ** 9(s)-hpote * smiles: ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo * inchi-key: ** rwkjtihnysiihw-mebvtjqtsa-m * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8678 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9(s)-hpote |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rwkjtihnysiihw-mebvtjqtsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 309.425 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8497]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9(s)-hpote}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rwkjtihnysiihw-mebvtjqtsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=309.425}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-8678
- common-name:
- 9(s)-hpote
- smiles:
- ccc=ccc=cc=cc(cccccccc([o-])=o)oo
- inchi-key:
- rwkjtihnysiihw-mebvtjqtsa-m
- molecular-weight:
- 309.425
