Difference between revisions of "ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8678 == * common-name: ** 9(s)-hpote * smiles: ** ccc=ccc=cc=cc(cccccccc([o-])=o)oo * inchi-key: ** rwkjtihnysiihw-mebvtjqtsa-m * mol...")
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == * common-name: ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosam...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8678 ==
+
== Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL ==
 
* common-name:
 
* common-name:
** 9(s)-hpote
+
** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r
* smiles:
 
** ccc=ccc=cc=cc(cccccccc([o-])=o)oo
 
* inchi-key:
 
** rwkjtihnysiihw-mebvtjqtsa-m
 
* molecular-weight:
 
** 309.425
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8497]]
+
* [[2.4.1.151-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9(s)-hpote}}
+
{{#set: common-name=an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r}}
{{#set: inchi-key=inchikey=rwkjtihnysiihw-mebvtjqtsa-m}}
 
{{#set: molecular-weight=309.425}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL

  • common-name:
    • an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality