Difference between revisions of "ALPHA-GLC-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUCONATE == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sqougzdysa-m * molec...")
(Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * smiles: ** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUCONATE ==
+
== Metabolite CPD-10809 ==
 
* common-name:
 
* common-name:
** d-gluconate
+
** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
+
** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** rghnjxzeokukbd-sqougzdysa-m
+
** acivvgbvovhfpq-rpdrrwsusa-l
 
* molecular-weight:
 
* molecular-weight:
** 195.149
+
** 353.228
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCONOKIN-RXN]]
+
* [[RXN-14171]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
+
* [[RXN-10057]]
* [[GLUCONOLACT-RXN]]
+
* [[RXN-14171]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-gluconate}}
+
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}}
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}}
+
{{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}}
{{#set: molecular-weight=195.149}}
+
{{#set: molecular-weight=353.228}}

Revision as of 18:59, 14 January 2021

Metabolite CPD-10809

  • common-name:
    • 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
  • smiles:
    • c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • acivvgbvovhfpq-rpdrrwsusa-l
  • molecular-weight:
    • 353.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality