Difference between revisions of "ALPHA-GLC-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.43-RXN 3.1.3.43-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...")
 
(Created page with "Category:metabolite == Metabolite ALPHA-GLC-6-P == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** n...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.43-RXN 3.1.3.43-RXN] ==
+
== Metabolite ALPHA-GLC-6-P ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** α-d-glucose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.3.43 ec-3.1.3.43]
+
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Pyruvate-Dehydrogenase-Phosphoserine]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[Pyruvate-dehydrogenase-L-serine]][c]
+
** nbschqhzlsjfnq-dvkngefbsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11483]]
+
** 258.121
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[G6PADH]]
−
== Pathway(s) ==
+
* [[G6PADHh]]
−
== Reconstruction information  ==
+
* [[G6PI]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
−
== External links  ==
+
* [[PGCM]]
−
* LIGAND-RXN:
+
* [[PGIA]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R03450 R03450]
+
* [[PGIAh]]
−
* UNIPROT:
+
* [[PGMTh]]
−
** [http://www.uniprot.org/uniprot/P35816 P35816]
+
* [[RXN-15312]]
−
{{#set: direction=left-to-right}}
+
* [[UG6PGT]]
−
{{#set: ec-number=ec-3.1.3.43}}
+
* [[UG6PGTn]]
−
{{#set: nb gene associated=1}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: nb pathway associated=0}}
+
* [[G6PI]]
−
{{#set: reconstruction category=annotation}}
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[PGCM]]
−
{{#set: reconstruction comment=n.a}}
+
* [[PGIA]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[PGIAh]]
 +
* [[PGMTh]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=α-d-glucose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-dvkngefbsa-l}}
 +
{{#set: molecular-weight=258.121}}

Latest revision as of 11:17, 18 March 2021

Metabolite ALPHA-GLC-6-P

  • common-name:
    • α-d-glucose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • nbschqhzlsjfnq-dvkngefbsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ALPHA-GLC-6-P&oldid=139739"