Difference between revisions of "ALPHA-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...")
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9957 ==
+
== Metabolite FRUCTOSE-6P ==
 
* common-name:
 
* common-name:
** ubiquinol-9
+
** β-d-fructofuranose 6-phosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** npcoqxavbjjzbq-wjnluyjisa-n
+
** bgwgxpapygqalx-arqdhwqxsa-l
 
* molecular-weight:
 
* molecular-weight:
** 797.255
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.1.90-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PFK_]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.64-RXN]]
+
* [[2.7.1.90-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[3.1.3.46-RXN]]
 +
* [[F16BDEPHOS-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-9}}
+
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
+
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
{{#set: molecular-weight=797.255}}
+
{{#set: molecular-weight=258.121}}

Revision as of 08:31, 15 March 2021