Difference between revisions of "ALPHA-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...")
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE == * common-name: ** α-d-glucopyranose * smiles: ** c(o)c1(oc(c(c(c1o)o)o)o) * inchi-key: ** wqzgkkkjijffok-dvkngefbs...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9957 ==
+
== Metabolite ALPHA-GLUCOSE ==
 
* common-name:
 
* common-name:
** ubiquinol-9
+
** α-d-glucopyranose
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
** c(o)c1(oc(c(c(c1o)o)o)o)
 
* inchi-key:
 
* inchi-key:
** npcoqxavbjjzbq-wjnluyjisa-n
+
** wqzgkkkjijffok-dvkngefbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 797.255
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ALDOSE-1-EPIMERASE-RXN]]
 +
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.64-RXN]]
+
* [[3.2.1.58-RXN]]
 +
* [[ALDOSE-1-EPIMERASE-RXN]]
 +
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
 +
* [[RXN-15312]]
 +
* [[TREHALA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-9}}
+
{{#set: common-name=α-d-glucopyranose}}
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-dvkngefbsa-n}}
{{#set: molecular-weight=797.255}}
+
{{#set: molecular-weight=180.157}}

Latest revision as of 11:17, 18 March 2021

Metabolite ALPHA-GLUCOSE

  • common-name:
    • α-d-glucopyranose
  • smiles:
    • c(o)c1(oc(c(c(c1o)o)o)o)
  • inchi-key:
    • wqzgkkkjijffok-dvkngefbsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality