Difference between revisions of "ALPHA-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5901 RXN-5901] == * direction: ** left-to-right * common-name: ** acetoacetyl-coa reductase * e...")
(Created page with "Category:metabolite == Metabolite CPD-7061 == * common-name: ** pheophorbide a * smiles: ** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=2...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5901 RXN-5901] ==
+
== Metabolite CPD-7061 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** acetoacetyl-coa reductase
+
** pheophorbide a
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.36 ec-1.1.1.36]
+
** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ACETOACETYL-COA]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-650]][c] '''+''' 1 [[NADP]][c]
+
** uxwyeazhzlzdgm-zvevzsnksa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06969]]
+
** 590.677
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-17252]]
−
* Gene: [[SJ01444]]
+
* [[RXN-7740]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=pheophorbide a}}
−
* [[PWY-5676]], acetyl-CoA fermentation to butanoate II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5676 PWY-5676]
+
{{#set: inchi-key=inchikey=uxwyeazhzlzdgm-zvevzsnksa-m}}
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=590.677}}
−
* [[PWY1-3]], polyhydroxybutanoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1-3 PWY1-3]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7216]], (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5741]], ethylmalonyl-CoA pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5741 PWY-5741]
 
−
** '''2''' reactions found over '''11''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=45798 45798]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01977 R01977]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=acetoacetyl-coa reductase}}
 
−
{{#set: ec-number=ec-1.1.1.36}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=4}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-7061

  • common-name:
    • pheophorbide a
  • smiles:
    • c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
  • inchi-key:
    • uxwyeazhzlzdgm-zvevzsnksa-m
  • molecular-weight:
    • 590.677

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ALPHA-GLUCOSE&oldid=48483"