Difference between revisions of "ALPHA-GLUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE == * common-name: ** α-d-glucopyranose * smiles: ** c(o)c1(oc(c(c(c1o)o)o)o) * inchi-key: ** wqzgkkkjijffok-dvkngefbs...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALPHA-GLUCOSE == |
* common-name: | * common-name: | ||
− | ** & | + | ** α-d-glucopyranose |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(o)c1(oc(c(c(c1o)o)o)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wqzgkkkjijffok-dvkngefbsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
− | + | * [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]] | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[2 | + | * [[3.2.1.58-RXN]] |
− | * [[ | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
− | + | * [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]] | |
− | + | * [[RXN-15312]] | |
− | * [[ | + | * [[TREHALA-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=& | + | {{#set: common-name=α-d-glucopyranose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-dvkngefbsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite ALPHA-GLUCOSE
- common-name:
- α-d-glucopyranose
- smiles:
- c(o)c1(oc(c(c(c1o)o)o)o)
- inchi-key:
- wqzgkkkjijffok-dvkngefbsa-n
- molecular-weight:
- 180.157