Difference between revisions of "ALPHA-GLUCOSE-16-BISPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.8-RXN 3.2.1.8-RXN] == * direction: ** left-to-right * common-name: ** endo-1,4-beta-xylanase...") |
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** α-glucose 1,6-bisphosphate |
− | + | * smiles: | |
− | * | + | ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-]) |
− | ** [ | + | * inchi-key: |
− | = | + | ** rwhozgraxywrnx-vfuothlcsa-j |
− | + | * molecular-weight: | |
− | + | ** 336.085 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-16998]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-16997]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=α-glucose 1,6-bisphosphate}} | |
− | + | {{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}} | |
− | + | {{#set: molecular-weight=336.085}} | |
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE
- common-name:
- α-glucose 1,6-bisphosphate
- smiles:
- c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
- inchi-key:
- rwhozgraxywrnx-vfuothlcsa-j
- molecular-weight:
- 336.085