Difference between revisions of "ALPHA-GLUCOSE-16-BISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16027 RXN-16027] == * direction: ** reversible * common-name: ** 1,2-diacylglycerol 3-beta-gala...")
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16027 RXN-16027] ==
+
== Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 1,2-diacylglycerol 3-beta-galactosyltransferase
+
** α-glucose 1,6-bisphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.46 ec-2.4.1.46]
+
** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-14553]][c] '''+''' 1 [[CPD-17272]][c] '''<=>''' 1 [[CPD-2187]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
** rwhozgraxywrnx-vfuothlcsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11730]]
+
** 336.085
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-16998]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-16997]]
−
* Gene: [[SJ14527]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=&alpha;-glucose 1,6-bisphosphate}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=336.085}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ02446]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ01255]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=1,2-diacylglycerol 3-beta-galactosyltransferase}}
 
−
{{#set: ec-number=ec-2.4.1.46}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE

  • common-name:
    • α-glucose 1,6-bisphosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
  • inchi-key:
    • rwhozgraxywrnx-vfuothlcsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ALPHA-GLUCOSE-16-BISPHOSPHATE&oldid=138873"