Difference between revisions of "ALPHA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7651 RXN-7651] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....") |
(Created page with "Category:metabolite == Metabolite ALPHA-TOCOPHEROL == * common-name: ** α-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) * inch...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ALPHA-TOCOPHEROL == |
− | * | + | * common-name: |
− | ** | + | ** α-tocopherol |
− | * | + | * smiles: |
− | ** | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) |
− | + | * inchi-key: | |
− | + | ** gvjhhuawpyxkbd-ieosbipesa-n | |
− | = | + | * molecular-weight: |
− | * | + | ** 430.713 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=α-tocopherol}} | |
− | + | {{#set: inchi-key=inchikey=gvjhhuawpyxkbd-ieosbipesa-n}} | |
− | + | {{#set: molecular-weight=430.713}} | |
− | |||
− | |||
− | |||
− | ** | ||
− | == | ||
− | |||
− | |||
− | |||
− | * | ||
− | == | ||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite ALPHA-TOCOPHEROL
- common-name:
- α-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c))
- inchi-key:
- gvjhhuawpyxkbd-ieosbipesa-n
- molecular-weight:
- 430.713