Difference between revisions of "ALPROSTADIL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
(Created page with "Category:metabolite == Metabolite ALPROSTADIL == * common-name: ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate * smiles: ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15436 ==
+
== Metabolite ALPROSTADIL ==
 
* common-name:
 
* common-name:
** (5z)-tetradecenoyl-coa
+
** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate
 
* smiles:
 
* smiles:
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
 
* inchi-key:
 
* inchi-key:
** mrvdzohjmltlhj-stfckwfxsa-j
+
** gmvprgqoioiimi-dwkjamrdsa-m
 
* molecular-weight:
 
* molecular-weight:
** 971.845
+
** 353.478
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14576]]
+
* [[1.1.1.197-RXN]]
* [[RXN-17783]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17782]]
+
* [[1.1.1.197-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=(13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate}}
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
+
{{#set: inchi-key=inchikey=gmvprgqoioiimi-dwkjamrdsa-m}}
{{#set: molecular-weight=971.845}}
+
{{#set: molecular-weight=353.478}}

Latest revision as of 11:13, 18 March 2021

Metabolite ALPROSTADIL

  • common-name:
    • (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate
  • smiles:
    • cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
  • inchi-key:
    • gmvprgqoioiimi-dwkjamrdsa-m
  • molecular-weight:
    • 353.478

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality