Difference between revisions of "AMINO-HYDROXYMETHYL-METHYL-PYR-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LAUROYLCOA-CPD == * common-name: ** lauroyl-coa * smiles: ** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P == * common-name: ** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine * smiles: ** cc1(n=cc(cop(=o)([o-])...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite LAUROYLCOA-CPD ==
+
== Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P ==
 
* common-name:
 
* common-name:
−
** lauroyl-coa
+
** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
 
* smiles:
 
* smiles:
−
** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
 
* inchi-key:
 
* inchi-key:
−
** ymcxghlsvalicc-gmhmeamdsa-j
+
** pkyfhkiyhbrtpi-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 945.808
+
** 217.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[ACACT6]]
+
* [[PYRIMSYN3-RXN]]
−
* [[ACACT6h]]
 
−
* [[ACOA120OR]]
 
−
* [[RXN-14262]]
 
−
* [[RXN-9627]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ACACT6]]
+
* [[OHMETPYRKIN-RXN]]
−
* [[RXN-14262]]
+
* [[PYRIMSYN1-RXN]]
−
* [[RXN-14268]]
 
−
* [[RXN-16393]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=lauroyl-coa}}
+
{{#set: common-name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}}
−
{{#set: inchi-key=inchikey=ymcxghlsvalicc-gmhmeamdsa-j}}
+
{{#set: inchi-key=inchikey=pkyfhkiyhbrtpi-uhfffaoysa-l}}
−
{{#set: molecular-weight=945.808}}
+
{{#set: molecular-weight=217.121}}

Latest revision as of 11:11, 18 March 2021

Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P

  • common-name:
    • 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
  • smiles:
    • cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
  • inchi-key:
    • pkyfhkiyhbrtpi-uhfffaoysa-l
  • molecular-weight:
    • 217.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=AMINO-HYDROXYMETHYL-METHYL-PYR-P&oldid=136872"