Difference between revisions of "AMINO-OXOBUT"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-MANNOSE == * common-name: ** gdp-α-d-mannose * smiles: ** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4...")
(Created page with "Category:metabolite == Metabolite AMINO-OXOBUT == * common-name: ** l-2-amino-3-oxobutanoate * smiles: ** cc(=o)c([n+])c([o-])=o * inchi-key: ** sauchdkdcuroao-vkhmyheasa-...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-MANNOSE ==
+
== Metabolite AMINO-OXOBUT ==
 
* common-name:
 
* common-name:
** gdp-α-d-mannose
+
** l-2-amino-3-oxobutanoate
 
* smiles:
 
* smiles:
** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
+
** cc(=o)c([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** mvmscbbuihutgj-gdjbgnaasa-l
+
** sauchdkdcuroao-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 603.329
+
** 117.104
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.142-RXN]]
+
* [[AKBLIG-RXN]]
* [[2.4.1.83-RXN]]
 
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
 
* [[GDPMANDEHYDRA-RXN]]
 
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[RXN-16602]]
 
* [[RXN-1882]]
 
* [[RXN-5462]]
 
* [[RXN-5463]]
 
* [[RXN-5464]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
+
* [[THREODEHYD-RXN]]
* [[RXN-1882]]
 
* [[RXN4FS-12]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-mannose}}
+
{{#set: common-name=l-2-amino-3-oxobutanoate}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-gdjbgnaasa-l}}
+
{{#set: inchi-key=inchikey=sauchdkdcuroao-vkhmyheasa-n}}
{{#set: molecular-weight=603.329}}
+
{{#set: molecular-weight=117.104}}

Latest revision as of 11:11, 18 March 2021

Metabolite AMINO-OXOBUT

  • common-name:
    • l-2-amino-3-oxobutanoate
  • smiles:
    • cc(=o)c([n+])c([o-])=o
  • inchi-key:
    • sauchdkdcuroao-vkhmyheasa-n
  • molecular-weight:
    • 117.104

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality