Difference between revisions of "AMINO-OXOBUT"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENYLOSUCC == * common-name: ** adenylo-succinate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=...")
(Created page with "Category:metabolite == Metabolite GDP-MANNOSE == * common-name: ** gdp-α-d-mannose * smiles: ** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENYLOSUCC ==
+
== Metabolite GDP-MANNOSE ==
 
* common-name:
 
* common-name:
** adenylo-succinate
+
** gdp-α-d-mannose
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-])))
+
** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
* inchi-key:
** ofbhppmpbojxrt-dpxqiynjsa-j
+
** mvmscbbuihutgj-gdjbgnaasa-l
 
* molecular-weight:
 
* molecular-weight:
** 459.265
+
** 603.329
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AAL_LPAREN_fum_RPAREN_]]
+
* [[2.4.1.142-RXN]]
* [[AMPSYN-RXN]]
+
* [[2.4.1.83-RXN]]
 +
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
 +
* [[GDPMANDEHYDRA-RXN]]
 +
* [[MANNPGUANYLTRANGDP-RXN]]
 +
* [[RXN-16602]]
 +
* [[RXN-1882]]
 +
* [[RXN-5462]]
 +
* [[RXN-5463]]
 +
* [[RXN-5464]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[MANNPGUANYLTRANGDP-RXN]]
* [[AMPSYN-RXN]]
+
* [[RXN-1882]]
 +
* [[RXN4FS-12]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenylo-succinate}}
+
{{#set: common-name=gdp-α-d-mannose}}
{{#set: inchi-key=inchikey=ofbhppmpbojxrt-dpxqiynjsa-j}}
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-gdjbgnaasa-l}}
{{#set: molecular-weight=459.265}}
+
{{#set: molecular-weight=603.329}}

Revision as of 13:07, 14 January 2021

Metabolite GDP-MANNOSE

  • common-name:
    • gdp-α-d-mannose
  • smiles:
    • c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
  • inchi-key:
    • mvmscbbuihutgj-gdjbgnaasa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality