Difference between revisions of "AMINO-PARATHION"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-207 == * common-name: ** phenylacetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite Uracil20-in-tRNAs == * common-name: ** a uracil20 in trna == Reaction(s) known to consume the compound == * RXN-12456 == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-207 ==
+
== Metabolite Uracil20-in-tRNAs ==
 
* common-name:
 
* common-name:
** phenylacetyl-coa
+
** a uracil20 in trna
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** zigifdrjfzyeeq-cecatxlmsa-j
 
* molecular-weight:
 
** 881.637
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10821]]
+
* [[RXN-12456]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetyl-coa}}
+
{{#set: common-name=a uracil20 in trna}}
{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
 
{{#set: molecular-weight=881.637}}
 

Revision as of 18:59, 14 January 2021

Metabolite Uracil20-in-tRNAs

  • common-name:
    • a uracil20 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality