Difference between revisions of "AMINO-PARATHION"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Uracil20-in-tRNAs == * common-name: ** a uracil20 in trna == Reaction(s) known to consume the compound == * RXN-12456 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AMINO-PARATHION == |
* common-name: | * common-name: | ||
| − | ** | + | ** amino-parathion |
| + | * smiles: | ||
| + | ** ccop(oc1(c=cc(=cc=1)n))(occ)=s | ||
| + | * inchi-key: | ||
| + | ** xizotxgjxstqdi-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 261.275 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[AMINOPARATHION-PHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=amino-parathion}} |
| + | {{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=261.275}} | ||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite AMINO-PARATHION
- common-name:
- amino-parathion
- smiles:
- ccop(oc1(c=cc(=cc=1)n))(occ)=s
- inchi-key:
- xizotxgjxstqdi-uhfffaoysa-n
- molecular-weight:
- 261.275
