Difference between revisions of "AMINO-PARATHION"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE == * common-name: ** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate == Reaction(s) known to con...")
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE ==
+
== Metabolite AMINO-PARATHION ==
 
* common-name:
 
* common-name:
** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate
+
** amino-parathion
 +
* smiles:
 +
** ccop(oc1(c=cc(=cc=1)n))(occ)=s
 +
* inchi-key:
 +
** xizotxgjxstqdi-uhfffaoysa-n
 +
* molecular-weight:
 +
** 261.275
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.67-RXN]]
+
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
* [[RXN-10036]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate}}
+
{{#set: common-name=amino-parathion}}
 +
{{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}}
 +
{{#set: molecular-weight=261.275}}

Latest revision as of 11:18, 18 March 2021

Metabolite AMINO-PARATHION

  • common-name:
    • amino-parathion
  • smiles:
    • ccop(oc1(c=cc(=cc=1)n))(occ)=s
  • inchi-key:
    • xizotxgjxstqdi-uhfffaoysa-n
  • molecular-weight:
    • 261.275

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality