Difference between revisions of "AMINO-PARATHION"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IPC == * common-name: ** an inositol-phospho-α hydroxyphytoceramide == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite AMINO-PARATHION == |
* common-name: | * common-name: | ||
− | ** | + | ** amino-parathion |
+ | * smiles: | ||
+ | ** ccop(oc1(c=cc(=cc=1)n))(occ)=s | ||
+ | * inchi-key: | ||
+ | ** xizotxgjxstqdi-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 261.275 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[AMINOPARATHION-PHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=amino-parathion}} |
+ | {{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=261.275}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite AMINO-PARATHION
- common-name:
- amino-parathion
- smiles:
- ccop(oc1(c=cc(=cc=1)n))(occ)=s
- inchi-key:
- xizotxgjxstqdi-uhfffaoysa-n
- molecular-weight:
- 261.275