Difference between revisions of "AMINO-PARATHION"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-773 RXN-773] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1.14...")
 
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-773 RXN-773] ==
+
== Metabolite AMINO-PARATHION ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** amino-parathion
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.13 ec-1.14.13]
+
** ccop(oc1(c=cc(=cc=1)n))(occ)=s
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-710]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-712]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
** xizotxgjxstqdi-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05072]]
+
** 261.275
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-2582]], brassinosteroid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2582 PWY-2582]
+
{{#set: common-name=amino-parathion}}
−
** '''4''' reactions found over '''21''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}}
−
* [[PWY-699]], brassinosteroid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699]
+
{{#set: molecular-weight=261.275}}
−
** '''3''' reactions found over '''25''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07454 R07454]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.14.13}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite AMINO-PARATHION

  • common-name:
    • amino-parathion
  • smiles:
    • ccop(oc1(c=cc(=cc=1)n))(occ)=s
  • inchi-key:
    • xizotxgjxstqdi-uhfffaoysa-n
  • molecular-weight:
    • 261.275

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=AMINO-PARATHION&oldid=139767"