Difference between revisions of "AMINOMETHYLDIHYDROLIPOYL-GCVH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...") |
(Created page with "Category:metabolite == Metabolite AMINOMETHYLDIHYDROLIPOYL-GCVH == * common-name: ** a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine == Reactio...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AMINOMETHYLDIHYDROLIPOYL-GCVH == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[GCVP-RXN]] |
| + | * [[GCVT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GCVP-RXN]] |
| + | * [[GCVT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite AMINOMETHYLDIHYDROLIPOYL-GCVH
- common-name:
- a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
