Difference between revisions of "AMINOMETHYLDIHYDROLIPOYL-GCVH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOy NODOy] == * direction: ** left-to-right * common-name: ** nitric oxide, nadph2:oxygen oxidore...")
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOy NODOy] ==
+
== Metabolite CPD-5821 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** nitric oxide, nadph2:oxygen oxidoreductase
+
** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
== Reaction formula ==
+
* smiles:
* 1.0 [[NADPH]][c] '''+''' 2.0 [[NITRIC-OXIDE]][c] '''+''' 2.0 [[OXYGEN-MOLECULE]][c] '''=>''' 1.0 [[NADP]][c] '''+''' 2.0 [[NITRATE]][c] '''+''' 1.0 [[PROTON]][c]
+
** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ04092]]
+
** whkyncpixmntrq-yfkpbyrvsa-m
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 201.118
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[RXN-6201]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
== External links  ==
+
* [[3.5.2.17-RXN]]
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
{{#set: common-name=nitric oxide, nadph2:oxygen oxidoreductase}}
+
{{#set: common-name=(s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}}
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=whkyncpixmntrq-yfkpbyrvsa-m}}
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=201.118}}
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-5821

  • common-name:
    • (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
  • smiles:
    • c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
  • inchi-key:
    • whkyncpixmntrq-yfkpbyrvsa-m
  • molecular-weight:
    • 201.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality