Difference between revisions of "AMMONIA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-uridine34 == * common-name: ** a uridine34 in trna == Reaction(s) known to consume the compound == * RXN-16820 * RXN0-2023 =...")
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-uridine34 ==
+
== Metabolite CPD-11523 ==
 
* common-name:
 
* common-name:
** a uridine34 in trna
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
 +
* smiles:
 +
** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 +
* inchi-key:
 +
** omdqviuydjawhx-qhzcmhftsa-j
 +
* molecular-weight:
 +
** 1027.866
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16820]]
+
* [[RXN-10702]]
* [[RXN0-2023]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10704]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a uridine34 in trna}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}}
 +
{{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}}
 +
{{#set: molecular-weight=1027.866}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-11523

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • omdqviuydjawhx-qhzcmhftsa-j
  • molecular-weight:
    • 1027.866

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality