Difference between revisions of "AMMONIA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11615 == * transcription-direction: ** negative * right-end-position: ** 226669 * left-end-position: ** 220341 * centisome-position: ** 28.2715...") |
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPDQT-36 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-[(3'-methylthio)propyl]malate |
| − | + | * smiles: | |
| − | * | + | ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] |
| − | + | * inchi-key: | |
| − | ** | + | ** sqxviiopmysncp-uhfffaoysa-l |
| − | + | * molecular-weight: | |
| − | + | ** 220.24 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN-18208]] | |
| − | = | + | * [[RXNQT-4165]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-18208]] |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=3-[(3'-methylthio)propyl]malate}} |
| − | ** | + | {{#set: inchi-key=inchikey=sqxviiopmysncp-uhfffaoysa-l}} |
| − | == | + | {{#set: molecular-weight=220.24}} |
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPDQT-36
- common-name:
- 3-[(3'-methylthio)propyl]malate
- smiles:
- c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
- inchi-key:
- sqxviiopmysncp-uhfffaoysa-l
- molecular-weight:
- 220.24
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(3'-methylthio)propyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
