Difference between revisions of "AMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14051 == * transcription-direction: ** negative * right-end-position: ** 324250 * left-end-position: ** 296527 * centisome-position: ** 90.63559...")
(Created page with "Category:metabolite == Metabolite AMP == * common-name: ** amp * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])([o-])=o * inchi-key: ** udmbcsslthhncd-k...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ14051 ==
+
== Metabolite AMP ==
* transcription-direction:
+
* common-name:
** negative
+
** amp
* right-end-position:
+
* smiles:
** 324250
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])([o-])=o
* left-end-position:
+
* inchi-key:
** 296527
+
** udmbcsslthhncd-kqynxxcusa-l
* centisome-position:
+
* molecular-weight:
** 90.63559   
+
** 345.208
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.4.10-RXN]]
== Reaction(s) associated ==
+
* [[ADENYL-KIN-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[AMP-DEAMINASE-RXN]]
 +
* [[AMP-DEPHOSPHORYLATION-RXN]]
 +
* [[AMP5N]]
 +
* [[AMPSYN-RXN]]
 +
* [[APPRT]]
 +
* [[ATAM]]
 +
* [[FAD-PYROPHOSPHATASE-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[R00157]]
 +
* [[RPDPK]]
 +
* [[RXN-11695]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[RXN-4307]]
 +
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.8.4.9-RXN]]
 +
* [[2.7.4.10-RXN]]
 +
* [[2.7.9.3-RXN]]
 +
* [[3.1.13.4-RXN]]
 +
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
 +
* [[4-COUMARATE--COA-LIGASE-RXN]]
 +
* [[6.1.1.24-RXN]]
 +
* [[6.2.1.34-RXN]]
 +
* [[6.3.4.10-RXN]]
 +
* [[6.3.4.11-RXN]]
 +
* [[6.3.4.9-RXN]]
 +
* [[AAL_LPAREN_fum_RPAREN_]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETOACETATE--COA-LIGASE-RXN]]
 +
* [[ACYLCOASYN-RXN]]
 +
* [[ADENOSINE-KINASE-RXN]]
 +
* [[ADENPRIBOSYLTRAN-RXN]]
 +
* [[ADENYLYLSULFATASE-RXN]]
 +
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 +
* [[ADNK]]
 +
* [[ADNKm]]
 +
* [[ADPSUGPPHOSPHAT-RXN]]
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 +
* [[AMPSYN-RXN]]
 +
* [[APPRT]]
 +
* [[APYRASE-RXN]]
 +
* [[ARDP]]
 +
* [[ARGININE--TRNA-LIGASE-RXN]]
 +
* [[ARGSUCCINSYN-RXN]]
 +
* [[ASNSYNA-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 +
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 +
* [[ATP-PYROPHOSPHATASE-RXN]]
 +
* [[BIOTINLIG-RXN]]
 +
* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
 +
* [[BUTYRATE--COA-LIGASE-RXN]]
 +
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 +
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
 +
* [[DNA-LIGASE-ATP-RXN]]
 +
* [[DNA-LIGASE-NAD+-RXN]]
 +
* [[FACOAL18111Z]]
 +
* [[FAD-PYROPHOSPHATASE-RXN]]
 +
* [[GDPPYPHOSKIN-RXN]]
 +
* [[GLURS-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[GMP-SYN-NH3-RXN]]
 +
* [[GTPPYPHOSKIN-RXN]]
 +
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 +
* [[HISTIDINE--TRNA-LIGASE-RXN]]
 +
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 +
* [[LEUCINE--TRNA-LIGASE-RXN]]
 +
* [[LINOLENOYL-RXN]]
 +
* [[LNLCCOAL]]
 +
* [[LNLNCACOAL]]
 +
* [[LYSINE--TRNA-LIGASE-RXN]]
 +
* [[METHIONINE--TRNA-LIGASE-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 +
* [[NADPYROPHOSPHAT-RXN]]
 +
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 +
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[R00157]]
 +
* [[R223-RXN]]
 +
* [[R5PDP]]
 +
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
 +
* [[RNA-LIGASE-ATP-RXN]]
 +
* [[RPDPK]]
 +
* [[RXN-10]]
 +
* [[RXN-10862]]
 +
* [[RXN-10919]]
 +
* [[RXN-1126]]
 +
* [[RXN-11695]]
 +
* [[RXN-12019]]
 +
* [[RXN-12184]]
 +
* [[RXN-12473]]
 +
* [[RXN-12502]]
 +
* [[RXN-12504]]
 +
* [[RXN-12978]]
 +
* [[RXN-13039]]
 +
* [[RXN-13167]]
 +
* [[RXN-13168]]
 +
* [[RXN-13290]]
 +
* [[RXN-13614]]
 +
* [[RXN-14553]]
 +
* [[RXN-14570]]
 +
* [[RXN-15284]]
 +
* [[RXN-15285]]
 +
* [[RXN-15287]]
 +
* [[RXN-15712]]
 +
* [[RXN-15733]]
 +
* [[RXN-16165]]
 +
* [[RXN-16380]]
 +
* [[RXN-16389]]
 +
* [[RXN-16393]]
 +
* [[RXN-16401]]
 +
* [[RXN-16402]]
 +
* [[RXN-16415]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[RXN-16418]]
 +
* [[RXN-16820]]
 +
* [[RXN-16821]]
 +
* [[RXN-17127]]
 +
* [[RXN-17155]]
 +
* [[RXN-17919]]
 +
* [[RXN-17927]]
 +
* [[RXN-1961]]
 +
* [[RXN-2001]]
 +
* [[RXN-7904]]
 +
* [[RXN-8348]]
 +
* [[RXN-8655]]
 +
* [[RXN-9386]]
 +
* [[RXN-9623]]
 +
* [[RXN-9644]]
 +
* [[RXN-9673]]
 +
* [[RXN0-1141]]
 +
* [[RXN0-1441]]
 +
* [[RXN0-2023]]
 +
* [[RXN0-2161]]
 +
* [[RXN0-4401]]
 +
* [[RXN0-5038]]
 +
* [[RXN0-5098]]
 +
* [[RXN0-6524]]
 +
* [[RXN0-7238]]
 +
* [[RXN0-7239]]
 +
* [[RXN0-7248]]
 +
* [[RXN1G-121]]
 +
* [[RXN66-469]]
 +
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
 +
* [[RXN66-477]]
 +
* [[RXN66-480]]
 +
* [[RXN66-483]]
 +
* [[RXN66-484]]
 +
* [[SERINE--TRNA-LIGASE-RXN]]
 +
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 +
* [[TRANS-RXN0-623]]
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 +
* [[TYROSINE--TRNA-LIGASE-RXN]]
 
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
** Category: [[annotation]]
+
* [[VALINE--TRNA-LIGASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[llcoas]]
== Pathway(s) associated ==
+
</div>
* [[PWY-7511]]
+
== Reaction(s) of unknown directionality ==
** '''7''' reactions found over '''9''' reactions in the full pathway
+
{{#set: common-name=amp}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=udmbcsslthhncd-kqynxxcusa-l}}
{{#set: right-end-position=324250}}
+
{{#set: molecular-weight=345.208}}
{{#set: left-end-position=296527}}
 
{{#set: centisome-position=90.63559    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite AMP

  • common-name:
    • amp
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])([o-])=o
  • inchi-key:
    • udmbcsslthhncd-kqynxxcusa-l
  • molecular-weight:
    • 345.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality