Difference between revisions of "AMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * smiles: ** c(cc(=o)c(=o)[o-])cc(=o)[o-] * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * mole...") |
(Created page with "Category:metabolite == Metabolite Reduced-2Fe-2S-Ferredoxins == * common-name: ** a reduced [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == * 2.8.1.6...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Reduced-2Fe-2S-Ferredoxins == |
* common-name: | * common-name: | ||
− | ** | + | ** a reduced [2fe-2s] ferredoxin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[2- | + | * [[2.8.1.6-RXN]] |
+ | * [[RXN-11586]] | ||
+ | * [[RXN-14950]] | ||
+ | * [[RXN-14957]] | ||
+ | * [[RXN-14959]] | ||
+ | * [[RXN-17472]] | ||
+ | * [[RXN0-949]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a reduced [2fe-2s] ferredoxin}} |
− | |||
− |
Revision as of 18:53, 14 January 2021
Contents
Metabolite Reduced-2Fe-2S-Ferredoxins
- common-name:
- a reduced [2fe-2s] ferredoxin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a reduced [2fe-2s] ferredoxin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.