Difference between revisions of "ANDROST4ENE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19610 == * transcription-direction: ** positive * right-end-position: ** 40009 * left-end-position: ** 25368 * centisome-position: ** 11.313434...") |
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DIHYDRONEOPTERIN-P == |
| − | * | + | * common-name: |
| − | ** | + | ** 7,8-dihydroneopterin 3'-phosphate |
| − | + | * smiles: | |
| − | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2)) | |
| − | + | * inchi-key: | |
| − | * | + | ** plsqmgzyogsoce-xinawcovsa-l |
| − | + | * molecular-weight: | |
| − | ** | + | ** 333.197 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=7,8-dihydroneopterin 3'-phosphate}} |
| − | + | {{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}} | |
| − | + | {{#set: molecular-weight=333.197}} | |
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite DIHYDRONEOPTERIN-P
- common-name:
- 7,8-dihydroneopterin 3'-phosphate
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
- inchi-key:
- plsqmgzyogsoce-xinawcovsa-l
- molecular-weight:
- 333.197
