Difference between revisions of "APS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3705 == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o * in...") |
(Created page with "Category:metabolite == Metabolite Light == * common-name: ** hν == Reaction(s) known to consume the compound == * DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN * ExchangeS...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Light == |
* common-name: | * common-name: | ||
| − | ** | + | ** hν |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]] | ||
| + | * [[ExchangeSeed-Light]] | ||
| + | * [[PSII-RXN]] | ||
| + | * [[RXN-5285]] | ||
| + | * [[RXN1F-10]] | ||
| + | * [[TransportSeed-Light]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-Light]] |
| + | * [[TransportSeed-Light]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hν}} |
| − | |||
| − | |||
Revision as of 15:26, 5 January 2021
Contents
Metabolite Light
- common-name:
- hν
Reaction(s) known to consume the compound
- DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN
- ExchangeSeed-Light
- PSII-RXN
- RXN-5285
- RXN1F-10
- TransportSeed-Light
