Difference between revisions of "APS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05706 == * transcription-direction: ** positive * right-end-position: ** 68367 * left-end-position: ** 57144 * centisome-position: ** 63.938774...")
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05706 ==
+
== Metabolite APS ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** adenosine 5'-phosphosulfate
−
* right-end-position:
+
* smiles:
−
** 68367
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 57144
+
** irlpacmltupbcl-kqynxxcusa-l
−
* centisome-position:
+
* molecular-weight:
−
** 63.938774   
+
** 425.266
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.8.4.9-RXN]]
−
== Reaction(s) associated ==
+
* [[ADENYLYLSULFATASE-RXN]]
−
* [[PROTEIN-KINASE-RXN]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
−
** Category: [[annotation]]
+
* [[ADENYLYLSULFKIN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[R163-RXN]]
−
{{#set: transcription-direction=positive}}
+
* [[RXN-12019]]
−
{{#set: right-end-position=68367}}
+
* [[SULFATE-ADENYLYLTRANS-RXN]]
−
{{#set: left-end-position=57144}}
+
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
−
{{#set: centisome-position=63.938774    }}
+
== Reaction(s) known to produce the compound ==
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
−
{{#set: nb reaction associated=1}}
+
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[R163-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=adenosine 5'-phosphosulfate}}
 +
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}
 +
{{#set: molecular-weight=425.266}}

Latest revision as of 11:13, 18 March 2021

Metabolite APS

  • common-name:
    • adenosine 5'-phosphosulfate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
  • inchi-key:
    • irlpacmltupbcl-kqynxxcusa-l
  • molecular-weight:
    • 425.266

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=APS&oldid=137631"