Difference between revisions of "ARACHIDIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7006 == * common-name: ** tetrahydrogeranylgeranyl chlorophyll a * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)c...")
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7006 ==
+
== Metabolite CPD-12321 ==
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl chlorophyll a
+
** 15-cis-phytoene
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c5(=[n+]([mg--]36([n+]1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** nvdidzkepdpxjj-onwagyjksa-m
+
** yvlpjigomtxxlp-bhljudrvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 890.479
+
** 544.946
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7666]]
+
* [[RXN-11355]]
 +
* [[RXN-12243]]
 +
* [[RXN-12413]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7665]]
+
* [[RXN-13323]]
 +
* [[RXNARA-8002]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: common-name=15-cis-phytoene}}
{{#set: inchi-key=inchikey=nvdidzkepdpxjj-onwagyjksa-m}}
+
{{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}}
{{#set: molecular-weight=890.479}}
+
{{#set: molecular-weight=544.946}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-12321

  • common-name:
    • 15-cis-phytoene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
  • inchi-key:
    • yvlpjigomtxxlp-bhljudrvsa-n
  • molecular-weight:
    • 544.946

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality