Difference between revisions of "ARACHIDIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite ARACHIDIC_ACID == * common-name: ** arachidate * smiles: ** cccccccccccccccccccc(=o)[o-] * inchi-key: ** vkobvwxkncxxde-uhfffaoysa-m * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ARACHIDIC_ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** arachidate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccccccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vkobvwxkncxxde-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 311.527 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9629]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=arachidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vkobvwxkncxxde-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=311.527}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite ARACHIDIC_ACID
- common-name:
- arachidate
- smiles:
- cccccccccccccccccccc(=o)[o-]
- inchi-key:
- vkobvwxkncxxde-uhfffaoysa-m
- molecular-weight:
- 311.527
