Difference between revisions of "ARACHIDIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == * common-name: ** (r,s)-tetrahydrobenzylisoquinoline * smiles: ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))...")
(Created page with "Category:metabolite == Metabolite tRNAPhe-Containing-4-demethylwyosine-37 == * common-name: ** 4-demethylwyosine37 in trnaphe == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE ==
+
== Metabolite tRNAPhe-Containing-4-demethylwyosine-37 ==
 
* common-name:
 
* common-name:
** (r,s)-tetrahydrobenzylisoquinoline
+
** 4-demethylwyosine37 in trnaphe
* smiles:
 
** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
 
* inchi-key:
 
** yrycifuzsumaay-uhfffaoysa-o
 
* molecular-weight:
 
** 224.325
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.115-RXN]]
+
* [[RXN-14518]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}}
+
{{#set: common-name=4-demethylwyosine37 in trnaphe}}
{{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}}
 
{{#set: molecular-weight=224.325}}
 

Revision as of 14:59, 5 January 2021

Metabolite tRNAPhe-Containing-4-demethylwyosine-37

  • common-name:
    • 4-demethylwyosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality