Difference between revisions of "ARACHIDIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOKINASE-RXN FRUCTOKINASE-RXN] == * direction: ** left-to-right * common-name: ** manno(fructo)...")
(Created page with "Category:metabolite == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == * common-name: ** (r,s)-tetrahydrobenzylisoquinoline * smiles: ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOKINASE-RXN FRUCTOKINASE-RXN] ==
+
== Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** manno(fructo)kinase
+
** (r,s)-tetrahydrobenzylisoquinoline
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.1.4 ec-2.7.1.4]
+
** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[BETA-D-FRUCTOSE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[PROTON]][c]
+
** yrycifuzsumaay-uhfffaoysa-o
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12224]]
+
** 224.325
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.1.1.115-RXN]]
* Gene: [[SJ04919]]
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}}
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}}
== Pathway(s) ==
+
{{#set: molecular-weight=224.325}}
* [[PWY-3801]], sucrose degradation II (sucrose synthase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801]
 
** '''4''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-621]], sucrose degradation III (sucrose invertase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-621 PWY-621]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
 
** '''16''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-4101]], D-sorbitol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-5384]], sucrose degradation IV (sucrose phosphorylase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[SUCROSEUTIL2-PWY]], sucrose degradation VII (sucrose 3-dehydrogenase): [http://metacyc.org/META/NEW-IMAGE?object=SUCROSEUTIL2-PWY SUCROSEUTIL2-PWY]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-6531]], mannitol cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531]
 
** '''4''' reactions found over '''5''' reactions in the full pathway
 
* [[SUCUTIL-PWY]], sucrose degradation I (sucrose phosphotransferase): [http://metacyc.org/META/NEW-IMAGE?object=SUCUTIL-PWY SUCUTIL-PWY]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16126 16126]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00760 R00760]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q09124 Q09124]
 
** [http://www.uniprot.org/uniprot/P24261 P24261]
 
** [http://www.uniprot.org/uniprot/Q03417 Q03417]
 
** [http://www.uniprot.org/uniprot/Q9V0T7 Q9V0T7]
 
** [http://www.uniprot.org/uniprot/Q9CFI9 Q9CFI9]
 
** [http://www.uniprot.org/uniprot/P22824 P22824]
 
** [http://www.uniprot.org/uniprot/P26420 P26420]
 
** [http://www.uniprot.org/uniprot/P26984 P26984]
 
** [http://www.uniprot.org/uniprot/P37829 P37829]
 
** [http://www.uniprot.org/uniprot/P43468 P43468]
 
** [http://www.uniprot.org/uniprot/P73521 P73521]
 
** [http://www.uniprot.org/uniprot/O82616 O82616]
 
** [http://www.uniprot.org/uniprot/O04897 O04897]
 
** [http://www.uniprot.org/uniprot/Q42645 Q42645]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=manno(fructo)kinase}}
 
{{#set: ec-number=ec-2.7.1.4}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=8}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE

  • common-name:
    • (r,s)-tetrahydrobenzylisoquinoline
  • smiles:
    • c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
  • inchi-key:
    • yrycifuzsumaay-uhfffaoysa-o
  • molecular-weight:
    • 224.325

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality