Difference between revisions of "ARACHIDONIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHOLINE == * common-name: ** choline * smiles: ** c(co)[n+](c)(c)c * inchi-key: ** oeyiohpdsnjkls-uhfffaoysa-n * molecular-weight: ** 104...") |
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ARACHIDONIC_ACID == |
* common-name: | * common-name: | ||
− | ** | + | ** arachidonate |
* smiles: | * smiles: | ||
− | ** | + | ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yzxbapsdxzzrgb-dofzraljsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 303.464 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ARACHIDONATE-15-LIPOXYGENASE-RXN]] |
− | * [[ | + | * [[ARACHIDONATE-5-LIPOXYGENASE-RXN]] |
− | + | * [[RXN-13395]] | |
− | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16016]] |
− | + | * [[RXN6666-2]] | |
− | * [[ | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=arachidonate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=303.464}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite ARACHIDONIC_ACID
- common-name:
- arachidonate
- smiles:
- cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
- inchi-key:
- yzxbapsdxzzrgb-dofzraljsa-m
- molecular-weight:
- 303.464