Difference between revisions of "ARACHIDONIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11011 == * transcription-direction: ** negative * right-end-position: ** 1263349 * left-end-position: ** 1253912 * centisome-position: ** 86.80721...")
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11011 ==
+
== Metabolite ARACHIDONIC_ACID ==
* transcription-direction:
+
* common-name:
** negative
+
** arachidonate
* right-end-position:
+
* smiles:
** 1263349
+
** cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
* left-end-position:
+
* inchi-key:
** 1253912
+
** yzxbapsdxzzrgb-dofzraljsa-m
* centisome-position:
+
* molecular-weight:
** 86.80721   
+
** 303.464
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
== Reaction(s) associated ==
+
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
* [[TRIOSEPISOMERIZATION-RXN]]
+
* [[RXN-13395]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-16016]]
== Pathway(s) associated ==
+
* [[RXN6666-2]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
* [[GLUCONEO-PWY]]
+
{{#set: common-name=arachidonate}}
** '''12''' reactions found over '''13''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}}
* [[CALVIN-PWY]]
+
{{#set: molecular-weight=303.464}}
** '''12''' reactions found over '''13''' reactions in the full pathway
 
* [[P185-PWY]]
 
** '''11''' reactions found over '''12''' reactions in the full pathway
 
* [[PWY-5484]]
 
** '''10''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY-1042]]
 
** '''9''' reactions found over '''10''' reactions in the full pathway
 
* [[P341-PWY]]
 
** '''6''' reactions found over '''10''' reactions in the full pathway
 
* [[GLYCOLYSIS]]
 
** '''11''' reactions found over '''12''' reactions in the full pathway
 
* [[ANAGLYCOLYSIS-PWY]]
 
** '''10''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY66-399]]
 
** '''11''' reactions found over '''12''' reactions in the full pathway
 
* [[PWY-6142]]
 
** '''10''' reactions found over '''13''' reactions in the full pathway
 
* [[PWY66-373]]
 
** '''3''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-7003]]
 
** '''8''' reactions found over '''6''' reactions in the full pathway
 
</div>
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=1263349}}
 
{{#set: left-end-position=1253912}}
 
{{#set: centisome-position=86.80721    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=12}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite ARACHIDONIC_ACID

  • common-name:
    • arachidonate
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
  • inchi-key:
    • yzxbapsdxzzrgb-dofzraljsa-m
  • molecular-weight:
    • 303.464

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality